Products 36482-24-3
CAS 36482-24-3 appears in our catalog under these names: Δ9-Tetrahydrocannabihexol, Δ9-THCH, DELTA9-tetrahydrocannabihexol. Offered by: Biosynth, MedChemExpress, Supelco. Available pack sizes: 10mg, 5mg, 25mg, 50mg, Get quote, 1ML.
(6aR,10aR)-3-hexyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol (CAS 36482-24-3) is a chemical compound with the molecular formula C22H32O2 and a molecular weight of 328.5 g/mol. IUPAC name: (6aR,10aR)-3-hexyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol. InChIKey: DMJVNNFBMZZLFB-QZTJIDSGSA-N.
| Molecular formula | C22H32O2 |
|---|---|
| Molecular weight | 328.5 g/mol |
| IUPAC name | (6aR,10aR)-3-hexyl-6,6,9-trimethyl-6a,7,8,10a-tetrahydrobenzo[c]chromen-1-ol |
| InChIKey | DMJVNNFBMZZLFB-QZTJIDSGSA-N |
| SMILES | CCCCCCC1=CC(=C2[C@@H]3C=C(CC[C@H]3C(OC2=C1)(C)C)C)O |
Computed by PubChem (NCBI)