CAS 36556-77-1 is the registry number for N-Deethylcyanazine amide. Offered by: TRC. Available pack sizes: 100mg, 25mg.
2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-methylpropanamide (CAS 36556-77-1) is a chemical compound with the molecular formula C7H11ClN6O and a molecular weight of 230.65 g/mol. IUPAC name: 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-methylpropanamide. InChIKey: NDKHTXLRCBVLMO-UHFFFAOYSA-N.
| Molecular formula | C7H11ClN6O |
|---|---|
| Molecular weight | 230.65 g/mol |
| IUPAC name | 2-[(4-amino-6-chloro-1,3,5-triazin-2-yl)amino]-2-methylpropanamide |
| InChIKey | NDKHTXLRCBVLMO-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)N)NC1=NC(=NC(=N1)N)Cl |
Computed by PubChem (NCBI)