Products 6494-81-1

CAS 6494-81-1 is the registry number for N-Nitroso Simazine, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

N-[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]-N-ethylnitrous amide (CAS 6494-81-1) is a chemical compound with the molecular formula C7H11ClN6O and a molecular weight of 230.65 g/mol. IUPAC name: N-[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]-N-ethylnitrous amide. InChIKey: OKVLOVNSJIXWJD-UHFFFAOYSA-N.

Identity
Molecular formulaC7H11ClN6O
Molecular weight230.65 g/mol
IUPAC nameN-[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]-N-ethylnitrous amide
InChIKeyOKVLOVNSJIXWJD-UHFFFAOYSA-N
SMILESCCNC1=NC(=NC(=N1)Cl)N(CC)N=O

Computed by PubChem (NCBI)