CAS 36624-61-0 appears in our catalog under these names: (2S,3S)-2,3-Bis(benzoyloxy)-4-(dimethylamino)-4-oxobutanoic acid, 98%, (2S,3S)-2,3-Bis(benzoyloxy)-4-(dimethylamino)-4-oxobutanoic acid, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
(2S,3S)-2,3-dibenzoyloxy-4-(dimethylamino)-4-oxobutanoic acid (CAS 36624-61-0) is a chemical compound with the molecular formula C20H19NO7 and a molecular weight of 385.4 g/mol. IUPAC name: (2S,3S)-2,3-dibenzoyloxy-4-(dimethylamino)-4-oxobutanoic acid. InChIKey: LINPSOODYGSBAH-HOTGVXAUSA-N.
| Molecular formula | C20H19NO7 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | (2S,3S)-2,3-dibenzoyloxy-4-(dimethylamino)-4-oxobutanoic acid |
| InChIKey | LINPSOODYGSBAH-HOTGVXAUSA-N |
| SMILES | CN(C)C(=O)[C@H]([C@@H](C(=O)O)OC(=O)C1=CC=CC=C1)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)