CAS 78761-37-2 is the registry number for (-)-O,O'-DIBENZOYL-L-TARTARIC ACID MONO&. Offered by: Sigma-Aldrich. Available pack sizes: 50G.
(2R,3R)-2,3-dibenzoyloxy-4-(dimethylamino)-4-oxobutanoic acid (CAS 78761-37-2) is a chemical compound with the molecular formula C20H19NO7 and a molecular weight of 385.4 g/mol. IUPAC name: (2R,3R)-2,3-dibenzoyloxy-4-(dimethylamino)-4-oxobutanoic acid. InChIKey: LINPSOODYGSBAH-HZPDHXFCSA-N.
| Molecular formula | C20H19NO7 |
|---|---|
| Molecular weight | 385.4 g/mol |
| IUPAC name | (2R,3R)-2,3-dibenzoyloxy-4-(dimethylamino)-4-oxobutanoic acid |
| InChIKey | LINPSOODYGSBAH-HZPDHXFCSA-N |
| SMILES | CN(C)C(=O)[C@@H]([C@H](C(=O)O)OC(=O)C1=CC=CC=C1)OC(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)