CAS 3663-35-2 appears in our catalog under these names: 4–ethyl–2–nitroaniline, 4-Ethyl-2-nitroaniline 97%, 4-Ethyl-2-nitroaniline, ≥97%, 4-Ethyl-2-nitrobenzenamine, 97%, 97%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g.
4-ethyl-2-nitroaniline (CAS 3663-35-2) is a chemical compound with the molecular formula C8H10N2O2 and a molecular weight of 166.18 g/mol. IUPAC name: 4-ethyl-2-nitroaniline. InChIKey: RUQAPQLDPWSAQM-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O2 |
|---|---|
| Molecular weight | 166.18 g/mol |
| IUPAC name | 4-ethyl-2-nitroaniline |
| InChIKey | RUQAPQLDPWSAQM-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=C(C=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)