CAS 3663-37-4 is the registry number for 3-Phenyl-1,2,4-oxadiazol-5-amine. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
3-phenyl-1,2,4-oxadiazol-5-amine (CAS 3663-37-4) is a chemical compound with the molecular formula C8H7N3O and a molecular weight of 161.16 g/mol. IUPAC name: 3-phenyl-1,2,4-oxadiazol-5-amine. InChIKey: DZHVJUCGKWKRTO-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O |
|---|---|
| Molecular weight | 161.16 g/mol |
| IUPAC name | 3-phenyl-1,2,4-oxadiazol-5-amine |
| InChIKey | DZHVJUCGKWKRTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NOC(=N2)N |
Computed by PubChem (NCBI)