CAS 36635-61-7 appears in our catalog under these names: Tosylmethyl Isocyanide, >95% (HPLC), p–Toluenesulfonylmethyl isocyanide, 4-Toluenesulfonylmethylisocyanide/ 98+%, p-Toluenesulfonylmethyl isocyanide, 97% , 4-Toluenesulfonylmethylisonitrile. Offered by: TRC, GLPBio, Chemat, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 50g, 5g, 100g, 500g, 25g, 0,25kg, 0,1kg, 0,5kg.
1-(isocyanomethylsulfonyl)-4-methylbenzene (CAS 36635-61-7) is a chemical compound with the molecular formula C9H9NO2S and a molecular weight of 195.24 g/mol. IUPAC name: 1-(isocyanomethylsulfonyl)-4-methylbenzene. InChIKey: CFOAUYCPAUGDFF-UHFFFAOYSA-N.
| Molecular formula | C9H9NO2S |
|---|---|
| Molecular weight | 195.24 g/mol |
| IUPAC name | 1-(isocyanomethylsulfonyl)-4-methylbenzene |
| InChIKey | CFOAUYCPAUGDFF-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C[N+]#[C-] |
Computed by PubChem (NCBI)