Products 366448-34-2
CAS 366448-34-2 appears in our catalog under these names: Serine Hydrolase inhibitor-21, Serine Hydrolase inhibitor–21, Serine Hydrolase inhibitor-21, 99.71%, 99.71%, Serine Hydrolase inhibitor-21, 99.71%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 2mg, 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 5 mg.
5-(phenothiazine-10-carbonyl)-1H-pyridin-2-one (CAS 366448-34-2) is a chemical compound with the molecular formula C18H12N2O2S and a molecular weight of 320.4 g/mol. IUPAC name: 5-(phenothiazine-10-carbonyl)-1H-pyridin-2-one. InChIKey: FRWOZZSGXZOOSM-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O2S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 5-(phenothiazine-10-carbonyl)-1H-pyridin-2-one |
| InChIKey | FRWOZZSGXZOOSM-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C3=CC=CC=C3S2)C(=O)C4=CNC(=O)C=C4 |
Computed by PubChem (NCBI)