Products 52559-39-4
CAS 52559-39-4 is the registry number for 6-((2-Aminophenyl)thio)-1H-benzo[de]isoquinoline-1,3(2H)-dione, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-(2-aminophenyl)sulfanylbenzo[de]isoquinoline-1,3-dione (CAS 52559-39-4) is a chemical compound with the molecular formula C18H12N2O2S and a molecular weight of 320.4 g/mol. IUPAC name: 6-(2-aminophenyl)sulfanylbenzo[de]isoquinoline-1,3-dione. InChIKey: JAJVVDUBZZVKRV-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O2S |
|---|---|
| Molecular weight | 320.4 g/mol |
| IUPAC name | 6-(2-aminophenyl)sulfanylbenzo[de]isoquinoline-1,3-dione |
| InChIKey | JAJVVDUBZZVKRV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)SC2=C3C=CC=C4C3=C(C=C2)C(=O)NC4=O |
Computed by PubChem (NCBI)