Products 36809-66-2

CAS 36809-66-2 is the registry number for 3-Chloroprop-1-ene-2-sulfonyl chloride, 95% mix TBC as stabilizer. Offered by: AmBeed. Available pack sizes: 1g.

3-chloroprop-1-ene-2-sulfonyl chloride (CAS 36809-66-2) is a chemical compound with the molecular formula C3H4Cl2O2S and a molecular weight of 175.03 g/mol. IUPAC name: 3-chloroprop-1-ene-2-sulfonyl chloride. InChIKey: DTRVXXBLQQSDEJ-UHFFFAOYSA-N.

Identity
Molecular formulaC3H4Cl2O2S
Molecular weight175.03 g/mol
IUPAC name3-chloroprop-1-ene-2-sulfonyl chloride
InChIKeyDTRVXXBLQQSDEJ-UHFFFAOYSA-N
SMILESC=C(CCl)S(=O)(=O)Cl

Computed by PubChem (NCBI)