Products 859056-31-8

CAS 859056-31-8 appears in our catalog under these names: 3-Chloroprop-2-ene-1-sulfonyl chloride, 95%, 3-Chloroprop-2-ene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.

(E)-3-chloroprop-2-ene-1-sulfonyl chloride (CAS 859056-31-8) is a chemical compound with the molecular formula C3H4Cl2O2S and a molecular weight of 175.03 g/mol. IUPAC name: (E)-3-chloroprop-2-ene-1-sulfonyl chloride. InChIKey: OZTXHUAINKWGIO-OWOJBTEDSA-N.

Identity
Molecular formulaC3H4Cl2O2S
Molecular weight175.03 g/mol
IUPAC name(E)-3-chloroprop-2-ene-1-sulfonyl chloride
InChIKeyOZTXHUAINKWGIO-OWOJBTEDSA-N
SMILESC(/C=C/Cl)S(=O)(=O)Cl

Computed by PubChem (NCBI)