CAS 3681-79-6 appears in our catalog under these names: NITRO-15N-BENZENE, 98+ ATOM % 15N, Nitrobenzene-¹⁵N, 98 atom % 15N;98% (CP), 98 atom % 15N;98% (CP). Offered by: Sigma-Aldrich, Chemat. Available pack sizes: 1G, 50mg, 250mg.
[oxido(oxo)(15N)(15N)azaniumyl]benzene (CAS 3681-79-6) is a chemical compound with the molecular formula C6H5NO2 and a molecular weight of 124.10 g/mol. IUPAC name: [oxido(oxo)(15N)(15N)azaniumyl]benzene. InChIKey: LQNUZADURLCDLV-CDYZYAPPSA-N.
| Molecular formula | C6H5NO2 |
|---|---|
| Molecular weight | 124.10 g/mol |
| IUPAC name | [oxido(oxo)(15N)(15N)azaniumyl]benzene |
| InChIKey | LQNUZADURLCDLV-CDYZYAPPSA-N |
| SMILES | C1=CC=C(C=C1)[15N+](=O)[O-] |
Computed by PubChem (NCBI)