CAS 36817-47-7 appears in our catalog under these names: 1-(2-Bromophenyl)-1h-pyrrole-2,5-dione, 97%, 1–(2–BROMO–PHENYL)–PYRROLE–2,5–DIONE, 1-(2-Bromophenyl)-1H-pyrrole-2,5-dione, 1-(2-Bromophenyl)-1H-pyrrole-2,5-dione, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 25g.
1-(2-bromophenyl)pyrrole-2,5-dione (CAS 36817-47-7) is a chemical compound with the molecular formula C10H6BrNO2 and a molecular weight of 252.06 g/mol. IUPAC name: 1-(2-bromophenyl)pyrrole-2,5-dione. InChIKey: ZTHZEDRPKCLGAR-UHFFFAOYSA-N.
| Molecular formula | C10H6BrNO2 |
|---|---|
| Molecular weight | 252.06 g/mol |
| IUPAC name | 1-(2-bromophenyl)pyrrole-2,5-dione |
| InChIKey | ZTHZEDRPKCLGAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=O)C=CC2=O)Br |
Computed by PubChem (NCBI)