CAS 3685-05-0 appears in our catalog under these names: (S)-6,6'-Dimethyl-(1,1'-biphenyl)-2,2'-diamine, 97%, (1S)-6,6'-Dimethyl[1,1'-biphenyl]-2,2'-diamine, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 100mg, 25mg.
2-(2-amino-6-methylphenyl)-3-methylaniline (CAS 3685-05-0) is a chemical compound with the molecular formula C14H16N2 and a molecular weight of 212.29 g/mol. IUPAC name: 2-(2-amino-6-methylphenyl)-3-methylaniline. InChIKey: MCUUKQCKNKUMBP-UHFFFAOYSA-N.
| Molecular formula | C14H16N2 |
|---|---|
| Molecular weight | 212.29 g/mol |
| IUPAC name | 2-(2-amino-6-methylphenyl)-3-methylaniline |
| InChIKey | MCUUKQCKNKUMBP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)N)C2=C(C=CC=C2N)C |
Computed by PubChem (NCBI)