Products 36881-02-4
CAS 36881-02-4 appears in our catalog under these names: 2-(4-Chlorophenyl)-2-methyl-1,3-dioxolane, 97%, 2-(4-Chlorophenyl)-2-methyl-1,3-dioxolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 25g, 100g, 10g, 1g, 5g.
2-(4-chlorophenyl)-2-methyl-1,3-dioxolane (CAS 36881-02-4) is a chemical compound with the molecular formula C10H11ClO2 and a molecular weight of 198.64 g/mol. IUPAC name: 2-(4-chlorophenyl)-2-methyl-1,3-dioxolane. InChIKey: GOYWGNGKHQRSJF-UHFFFAOYSA-N.
| Molecular formula | C10H11ClO2 |
|---|---|
| Molecular weight | 198.64 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-2-methyl-1,3-dioxolane |
| InChIKey | GOYWGNGKHQRSJF-UHFFFAOYSA-N |
| SMILES | CC1(OCCO1)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)