Products 36901-75-4

CAS 36901-75-4 is the registry number for (2-Bromobenzyl)triphenylphosphonium bromide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.

Structural formula: {0} (CAS {1})

(2-bromophenyl)methyl-triphenylphosphanium bromide (CAS 36901-75-4) is a chemical compound with the molecular formula C25H21Br2P and a molecular weight of 512.2 g/mol. IUPAC name: (2-bromophenyl)methyl-triphenylphosphanium bromide. InChIKey: MIUPTFWVTVISEG-UHFFFAOYSA-M.

Identity
Molecular formulaC25H21Br2P
Molecular weight512.2 g/mol
IUPAC name(2-bromophenyl)methyl-triphenylphosphanium bromide
InChIKeyMIUPTFWVTVISEG-UHFFFAOYSA-M
SMILESC1=CC=C(C=C1)[P+](CC2=CC=CC=C2Br)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-]

Computed by PubChem (NCBI)