CAS 36901-75-4 is the registry number for (2-Bromobenzyl)triphenylphosphonium bromide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 300g.
(2-bromophenyl)methyl-triphenylphosphanium bromide (CAS 36901-75-4) is a chemical compound with the molecular formula C25H21Br2P and a molecular weight of 512.2 g/mol. IUPAC name: (2-bromophenyl)methyl-triphenylphosphanium bromide. InChIKey: MIUPTFWVTVISEG-UHFFFAOYSA-M.
| Molecular formula | C25H21Br2P |
|---|---|
| Molecular weight | 512.2 g/mol |
| IUPAC name | (2-bromophenyl)methyl-triphenylphosphanium bromide |
| InChIKey | MIUPTFWVTVISEG-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CC2=CC=CC=C2Br)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)