CAS 51044-13-4 appears in our catalog under these names: (4-Bromobenzyl)triphenylphosphonium bromide, 98% , (4-Bromobenzyl)triphenylphosphonium bromide, 97%, (4-Bromobenzyl)triphenylphosphonium bromide, 97%, 97%, (4-Bromobenzyl)triphenylphosphonium Bromide, >98.0%(HPLC)(T). Offered by: Thermo Scientific (Alfa Aesar), Fluorochem, Ambeed, Chemat, TCI. Available pack sizes: 5g, 25g, 10g, 100g, 500g.
(4-bromophenyl)methyl-triphenylphosphanium bromide (CAS 51044-13-4) is a chemical compound with the molecular formula C25H21Br2P and a molecular weight of 512.2 g/mol. IUPAC name: (4-bromophenyl)methyl-triphenylphosphanium bromide. InChIKey: FQJYKXVQABPCRA-UHFFFAOYSA-M.
| Molecular formula | C25H21Br2P |
|---|---|
| Molecular weight | 512.2 g/mol |
| IUPAC name | (4-bromophenyl)methyl-triphenylphosphanium bromide |
| InChIKey | FQJYKXVQABPCRA-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)[P+](CC2=CC=C(C=C2)Br)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)