Products 369651-26-3
CAS 369651-26-3 is the registry number for ( 1S,2R,5S)-1-(but-3-en-2-yl)-2-Isopropyl-5-methylcyclohexan-1-ol. Offered by: Biosynth. Available pack sizes: 500mg, 1000mg.
(1S,2R,5S)-1-but-3-en-2-yl-5-methyl-2-propan-2-ylcyclohexan-1-ol (CAS 369651-26-3) is a chemical compound with the molecular formula C14H26O and a molecular weight of 210.36 g/mol. IUPAC name: (1S,2R,5S)-1-but-3-en-2-yl-5-methyl-2-propan-2-ylcyclohexan-1-ol. InChIKey: WCMAEEUFQIRPIB-FUEJHIMDSA-N.
| Molecular formula | C14H26O |
|---|---|
| Molecular weight | 210.36 g/mol |
| IUPAC name | (1S,2R,5S)-1-but-3-en-2-yl-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| InChIKey | WCMAEEUFQIRPIB-FUEJHIMDSA-N |
| SMILES | C[C@H]1CC[C@@H]([C@](C1)(C(C)C=C)O)C(C)C |
Computed by PubChem (NCBI)