Products 945736-77-6
CAS 945736-77-6 is the registry number for (1R,2S,5R)-1-(But-3-en-2-yl)-2-isopropyl-5-methylcyclohexan-1-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2S,5R)-1-but-3-en-2-yl-5-methyl-2-propan-2-ylcyclohexan-1-ol (CAS 945736-77-6) is a chemical compound with the molecular formula C14H26O and a molecular weight of 210.36 g/mol. IUPAC name: (1R,2S,5R)-1-but-3-en-2-yl-5-methyl-2-propan-2-ylcyclohexan-1-ol. InChIKey: WCMAEEUFQIRPIB-NIWMIYJQSA-N.
| Molecular formula | C14H26O |
|---|---|
| Molecular weight | 210.36 g/mol |
| IUPAC name | (1R,2S,5R)-1-but-3-en-2-yl-5-methyl-2-propan-2-ylcyclohexan-1-ol |
| InChIKey | WCMAEEUFQIRPIB-NIWMIYJQSA-N |
| SMILES | C[C@@H]1CC[C@H]([C@@](C1)(C(C)C=C)O)C(C)C |
Computed by PubChem (NCBI)