CAS 370104-05-5 appears in our catalog under these names: 1-(3-(Bromomethyl)phenyl)-2,2,2-trifluoroethan-1-one, 95%, 1-(3-(Bromomethyl)phenyl)-2,2,2-trifluoroethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-[3-(bromomethyl)phenyl]-2,2,2-trifluoroethanone (CAS 370104-05-5) is a chemical compound with the molecular formula C9H6BrF3O and a molecular weight of 267.04 g/mol. IUPAC name: 1-[3-(bromomethyl)phenyl]-2,2,2-trifluoroethanone. InChIKey: PJBFZGACRBKRKV-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF3O |
|---|---|
| Molecular weight | 267.04 g/mol |
| IUPAC name | 1-[3-(bromomethyl)phenyl]-2,2,2-trifluoroethanone |
| InChIKey | PJBFZGACRBKRKV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)C(F)(F)F)CBr |
Computed by PubChem (NCBI)