Products 37055-51-9
CAS 37055-51-9 appears in our catalog under these names: Diphenyl-d10-amine, 98 atom % D, min 98% Chemical Purity, Diphenylamine-d10, >95% (GC), D10-Diphenylamine, D10-Diphenylamine, Concentration: 100 µg/ml Solvent: Ethyl acetate. Offered by: CDN, TRC, HPC Standards. Available pack sizes: 0,5g, 0,1g, 100mg, 1g, 500mg, 1x10mg, 1x1ml.
2,3,4,5,6-pentadeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)aniline (CAS 37055-51-9) is a chemical compound with the molecular formula C12H11N and a molecular weight of 179.28 g/mol. IUPAC name: 2,3,4,5,6-pentadeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)aniline. InChIKey: DMBHHRLKUKUOEG-LHNTUAQVSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 179.28 g/mol |
| IUPAC name | 2,3,4,5,6-pentadeuterio-N-(2,3,4,5,6-pentadeuteriophenyl)aniline |
| InChIKey | DMBHHRLKUKUOEG-LHNTUAQVSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NC2=C(C(=C(C(=C2[2H])[2H])[2H])[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)