Products 99234-91-0
CAS 99234-91-0 appears in our catalog under these names: Diphenyl-2,2',4,4',6,6'-d6-amine, 98 atom % D, min 98% Chemical Purity, Diphenyl-2,2',4,4',6,6'-d6-amine. Offered by: CDN, TRC. Available pack sizes: 0,25g, 0,1g, 2,5mg, 25mg, 5mg.
2,4,6-trideuterio-N-(2,4,6-trideuteriophenyl)aniline (CAS 99234-91-0) is a chemical compound with the molecular formula C12H11N and a molecular weight of 175.26 g/mol. IUPAC name: 2,4,6-trideuterio-N-(2,4,6-trideuteriophenyl)aniline. InChIKey: DMBHHRLKUKUOEG-MWJWXFQUSA-N.
| Molecular formula | C12H11N |
|---|---|
| Molecular weight | 175.26 g/mol |
| IUPAC name | 2,4,6-trideuterio-N-(2,4,6-trideuteriophenyl)aniline |
| InChIKey | DMBHHRLKUKUOEG-MWJWXFQUSA-N |
| SMILES | [2H]C1=CC(=C(C(=C1)[2H])NC2=C(C=C(C=C2[2H])[2H])[2H])[2H] |
Computed by PubChem (NCBI)