CAS 37067-27-9 appears in our catalog under these names: Hydroquinone monosulfate potassium salt, 95%, Potassium Hydroquinone Monosulfate, Potassium 4-hydroxyphenyl sulfate, 95%, 95%, Potassium 4-hydroxyphenyl sulfate, 98%(T). Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 2,5g, 50mg, 100mg, 250mg.
Potassium (4-hydroxyphenyl) sulfate (CAS 37067-27-9) is a chemical compound with the molecular formula C6H5KO5S and a molecular weight of 228.27 g/mol. IUPAC name: potassium (4-hydroxyphenyl) sulfate. InChIKey: KYQHUXZXYUBUPX-UHFFFAOYSA-M.
| Molecular formula | C6H5KO5S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | potassium (4-hydroxyphenyl) sulfate |
| InChIKey | KYQHUXZXYUBUPX-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1O)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)