CAS 68944-25-2 is the registry number for Catechol-O-sulphate Potassium Salt, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
Potassium (2-hydroxyphenyl) sulfate (CAS 68944-25-2) is a chemical compound with the molecular formula C6H5KO5S and a molecular weight of 228.27 g/mol. IUPAC name: potassium (2-hydroxyphenyl) sulfate. InChIKey: DKBMQPBPXYZCGD-UHFFFAOYSA-M.
| Molecular formula | C6H5KO5S |
|---|---|
| Molecular weight | 228.27 g/mol |
| IUPAC name | potassium (2-hydroxyphenyl) sulfate |
| InChIKey | DKBMQPBPXYZCGD-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)O)OS(=O)(=O)[O-].[K+] |
Computed by PubChem (NCBI)