CAS 3707-98-0 appears in our catalog under these names: 4-Chloro-5-(dimethylamino)-2-phenyl-3(2h)-pyridazinone, 95%, SAN 9785. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 100mg, 50mg.
4-chloro-5-(dimethylamino)-2-phenylpyridazin-3-one (CAS 3707-98-0) is a chemical compound with the molecular formula C12H12ClN3O and a molecular weight of 249.69 g/mol. IUPAC name: 4-chloro-5-(dimethylamino)-2-phenylpyridazin-3-one. InChIKey: HMJHBWNOBINIKP-UHFFFAOYSA-N.
| Molecular formula | C12H12ClN3O |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | 4-chloro-5-(dimethylamino)-2-phenylpyridazin-3-one |
| InChIKey | HMJHBWNOBINIKP-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C(=O)N(N=C1)C2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)