Products 37081-77-9
CAS 37081-77-9 is the registry number for 7-Hydroxy Loxapine N-Oxide. Offered by: TRC. Available pack sizes: 50mg.
8-chloro-6-(4-methyl-4-oxidopiperazin-4-ium-1-yl)benzo[b][1,4]benzoxazepin-2-ol (CAS 37081-77-9) is a chemical compound with the molecular formula C18H18ClN3O3 and a molecular weight of 359.8 g/mol. IUPAC name: 8-chloro-6-(4-methyl-4-oxidopiperazin-4-ium-1-yl)benzo[b][1,4]benzoxazepin-2-ol. InChIKey: RORRKCSQKYYEFG-UHFFFAOYSA-N.
| Molecular formula | C18H18ClN3O3 |
|---|---|
| Molecular weight | 359.8 g/mol |
| IUPAC name | 8-chloro-6-(4-methyl-4-oxidopiperazin-4-ium-1-yl)benzo[b][1,4]benzoxazepin-2-ol |
| InChIKey | RORRKCSQKYYEFG-UHFFFAOYSA-N |
| SMILES | C[N+]1(CCN(CC1)C2=NC3=C(C=C(C=C3)O)OC4=C2C=C(C=C4)Cl)[O-] |
Computed by PubChem (NCBI)