CAS 431996-53-1 appears in our catalog under these names: Filastatin, 95%, Filastatin, Filastatin/ 99.61% (existing batch purity), 1-(3-chloro-4-methylbenzoyl)-4-(4-nitrophenyl)piperazine, 98%, 98%, Filastatin, 99.27%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 100mg, 10mg, 25mg, 5mg, 50mg, 200mg.
(3-chloro-4-methylphenyl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone (CAS 431996-53-1) is a chemical compound with the molecular formula C18H18ClN3O3 and a molecular weight of 359.8 g/mol. IUPAC name: (3-chloro-4-methylphenyl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone. InChIKey: PNECWWUOUHGWQG-UHFFFAOYSA-N.
| Molecular formula | C18H18ClN3O3 |
|---|---|
| Molecular weight | 359.8 g/mol |
| IUPAC name | (3-chloro-4-methylphenyl)-[4-(4-nitrophenyl)piperazin-1-yl]methanone |
| InChIKey | PNECWWUOUHGWQG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)N2CCN(CC2)C3=CC=C(C=C3)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)