CAS 37105-11-6 appears in our catalog under these names: 6-Chloro-5-methylpyridine-3-sulfonamide, 97%, 6-Chloro-5-methylpyridine-3-sulfonamide, 97%, 97%, 6-Chloro-5-methyl-pyridine-3-sulfonic acid amide, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g.
6-chloro-5-methylpyridine-3-sulfonamide (CAS 37105-11-6) is a chemical compound with the molecular formula C6H7ClN2O2S and a molecular weight of 206.65 g/mol. IUPAC name: 6-chloro-5-methylpyridine-3-sulfonamide. InChIKey: YXNUVSNPTCUVRU-UHFFFAOYSA-N.
| Molecular formula | C6H7ClN2O2S |
|---|---|
| Molecular weight | 206.65 g/mol |
| IUPAC name | 6-chloro-5-methylpyridine-3-sulfonamide |
| InChIKey | YXNUVSNPTCUVRU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CN=C1Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)