CAS 3711-01-1 appears in our catalog under these names: 1H,3H-Naphtho(2,3-c:6,7-c')difuran-1,3,6,8-tetraone, 97%, 2,3,6,7-Naphthalenetetracarboxylic 2,3:6,7-Dianhydride, >97.0%(HPLC)(T), 2,3,6,7-Naphthalenetetracarboxylic2,3:6,7-dianhydride, 97%,RG, 97%,RG. Offered by: AmBeed, TCI, Chemat. Available pack sizes: 5g, 1g, 100mg, 200mg.
[2]benzofuro[5,6-f][2]benzofuran-1,3,6,8-tetrone (CAS 3711-01-1) is a chemical compound with the molecular formula C14H4O6 and a molecular weight of 268.18 g/mol. IUPAC name: [2]benzofuro[5,6-f][2]benzofuran-1,3,6,8-tetrone. InChIKey: GIFXHNWKMSFJET-UHFFFAOYSA-N.
| Molecular formula | C14H4O6 |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | [2]benzofuro[5,6-f][2]benzofuran-1,3,6,8-tetrone |
| InChIKey | GIFXHNWKMSFJET-UHFFFAOYSA-N |
| SMILES | C1=C2C=C3C(=CC2=CC4=C1C(=O)OC4=O)C(=O)OC3=O |
Computed by PubChem (NCBI)