CAS 3711-03-3 appears in our catalog under these names: Naphtho[1,2-c:5,6-c']difuran-1,3,6,8-tetraone, >95.0%(HPLC)(T), Naphtho[1,2-c:5,6-c']difuran-1,3,6,8-tetraone, 95.0%, 95.0%. Offered by: TCI, Chemat. Available pack sizes: 1g.
[2]benzofuro[5,4-e][2]benzofuran-1,3,6,8-tetrone (CAS 3711-03-3) is a chemical compound with the molecular formula C14H4O6 and a molecular weight of 268.18 g/mol. IUPAC name: [2]benzofuro[5,4-e][2]benzofuran-1,3,6,8-tetrone. InChIKey: NCILSZDIXQXFQA-UHFFFAOYSA-N.
| Molecular formula | C14H4O6 |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | [2]benzofuro[5,4-e][2]benzofuran-1,3,6,8-tetrone |
| InChIKey | NCILSZDIXQXFQA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C1C4=C(C=C3)C(=O)OC4=O)C(=O)OC2=O |
Computed by PubChem (NCBI)