Products 371116-39-1
CAS 371116-39-1 appears in our catalog under these names: Progranulin modulator–3, Progranulin modulator-3, 99.95%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg, 10mM/1mL, 10 mg, 25 mg.
N-(2-phenyl-1,3-benzoxazol-5-yl)furan-2-carboxamide (CAS 371116-39-1) is a chemical compound with the molecular formula C18H12N2O3 and a molecular weight of 304.3 g/mol. IUPAC name: N-(2-phenyl-1,3-benzoxazol-5-yl)furan-2-carboxamide. InChIKey: YVAABBIEUQFOLE-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O3 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | N-(2-phenyl-1,3-benzoxazol-5-yl)furan-2-carboxamide |
| InChIKey | YVAABBIEUQFOLE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(O2)C=CC(=C3)NC(=O)C4=CC=CO4 |
Computed by PubChem (NCBI)