CAS 852180-49-5 is the registry number for 2-((5-Phenyl-1,2-oxazol-3-yl)methyl)-2,3-dihydro-1H-isoindole-1,3-dione, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-[(5-phenyl-1,2-oxazol-3-yl)methyl]isoindole-1,3-dione (CAS 852180-49-5) is a chemical compound with the molecular formula C18H12N2O3 and a molecular weight of 304.3 g/mol. IUPAC name: 2-[(5-phenyl-1,2-oxazol-3-yl)methyl]isoindole-1,3-dione. InChIKey: PNORFBXFSIHBCY-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O3 |
|---|---|
| Molecular weight | 304.3 g/mol |
| IUPAC name | 2-[(5-phenyl-1,2-oxazol-3-yl)methyl]isoindole-1,3-dione |
| InChIKey | PNORFBXFSIHBCY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=NO2)CN3C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)