CAS 37158-47-7 appears in our catalog under these names: Clenpenterol Hydrochloride, >95% (HPLC), Clenpenterol hydrochloride, CLENPENTEROL HYDROCHLORIDE VETRANAL, Clenpenterol hydrochloride, Concentration: 100 µg/ml Solvent: Methanol. Offered by: TRC, Dr. Ehrenstorfer, Sigma-Aldrich, HPC Standards. Available pack sizes: 100mg, 10mg, 1x1ml, 1x10mg.
1-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride (CAS 37158-47-7) is a chemical compound with the molecular formula C13H21Cl3N2O and a molecular weight of 327.7 g/mol. IUPAC name: 1-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride. InChIKey: HJGDYFOIRCZBLH-UHFFFAOYSA-N.
| Molecular formula | C13H21Cl3N2O |
|---|---|
| Molecular weight | 327.7 g/mol |
| IUPAC name | 1-(4-amino-3,5-dichlorophenyl)-2-(2-methylbutan-2-ylamino)ethanol;hydrochloride |
| InChIKey | HJGDYFOIRCZBLH-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)NCC(C1=CC(=C(C(=C1)Cl)N)Cl)O.Cl |
Computed by PubChem (NCBI)