Products 43091-72-1

CAS 43091-72-1 is the registry number for Urapidil Impurity 25. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

1-(2-chloroethyl)-4-(2-methoxyphenyl)piperazine;dihydrochloride (CAS 43091-72-1) is a chemical compound with the molecular formula C13H21Cl3N2O and a molecular weight of 327.7 g/mol. IUPAC name: 1-(2-chloroethyl)-4-(2-methoxyphenyl)piperazine;dihydrochloride. InChIKey: VAZCTMNZAXXBKW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21Cl3N2O
Molecular weight327.7 g/mol
IUPAC name1-(2-chloroethyl)-4-(2-methoxyphenyl)piperazine;dihydrochloride
InChIKeyVAZCTMNZAXXBKW-UHFFFAOYSA-N
SMILESCOC1=CC=CC=C1N2CCN(CC2)CCCl.Cl.Cl

Computed by PubChem (NCBI)