CAS 372107-34-1 appears in our catalog under these names: 3-(4-Bromophenyl)-1-phenyl-1h-pyrazole-4-carboxylic acid, 95%, 3-(4-Bromophenyl)-1-phenyl-1H-pyrazole-4-carboxylic acid, 95+%, 3–(4–Bromophenyl)–1–phenyl–1h–pyrazole–4–carboxylic acid, 3-(4-bromophenyl)-1-phenyl-1H-pyrazole-4-carboxylic acid, 3-(4-Bromophenyl)-1-phenyl-1h-pyrazole-4-carboxylic acid, 95+%, 95+%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 1g, 25g, 5g, 100mg, 2,5g, 50mg, 500mg.
3-(4-bromophenyl)-1-phenylpyrazole-4-carboxylic acid (CAS 372107-34-1) is a chemical compound with the molecular formula C16H11BrN2O2 and a molecular weight of 343.17 g/mol. IUPAC name: 3-(4-bromophenyl)-1-phenylpyrazole-4-carboxylic acid. InChIKey: VQAJKAHGYFKISS-UHFFFAOYSA-N.
| Molecular formula | C16H11BrN2O2 |
|---|---|
| Molecular weight | 343.17 g/mol |
| IUPAC name | 3-(4-bromophenyl)-1-phenylpyrazole-4-carboxylic acid |
| InChIKey | VQAJKAHGYFKISS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C=C(C(=N2)C3=CC=C(C=C3)Br)C(=O)O |
Computed by PubChem (NCBI)