Products 618101-91-0

CAS 618101-91-0 is the registry number for 1-(4-Bromophenyl)-3-phenyl-1H-pyrazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

1-(4-bromophenyl)-3-phenylpyrazole-5-carboxylic acid (CAS 618101-91-0) is a chemical compound with the molecular formula C16H11BrN2O2 and a molecular weight of 343.17 g/mol. IUPAC name: 1-(4-bromophenyl)-3-phenylpyrazole-5-carboxylic acid. InChIKey: SKTSJINMYBCNEB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H11BrN2O2
Molecular weight343.17 g/mol
IUPAC name1-(4-bromophenyl)-3-phenylpyrazole-5-carboxylic acid
InChIKeySKTSJINMYBCNEB-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C2=NN(C(=C2)C(=O)O)C3=CC=C(C=C3)Br

Computed by PubChem (NCBI)