Products 372520-84-8

CAS 372520-84-8 is the registry number for Ethyl 6,6''-dimethyl-[2,2':6',2''-terpyridine]-4'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Ethyl 2,6-bis(6-methyl-2-pyridinyl)pyridine-4-carboxylate (CAS 372520-84-8) is a chemical compound with the molecular formula C20H19N3O2 and a molecular weight of 333.4 g/mol. IUPAC name: ethyl 2,6-bis(6-methyl-2-pyridinyl)pyridine-4-carboxylate. InChIKey: DNGNIRYAQCEXKI-UHFFFAOYSA-N.

Identity
Molecular formulaC20H19N3O2
Molecular weight333.4 g/mol
IUPAC nameethyl 2,6-bis(6-methyl-2-pyridinyl)pyridine-4-carboxylate
InChIKeyDNGNIRYAQCEXKI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC(=NC(=C1)C2=CC=CC(=N2)C)C3=CC=CC(=N3)C

Computed by PubChem (NCBI)