CAS 372520-84-8 is the registry number for Ethyl 6,6''-dimethyl-[2,2':6',2''-terpyridine]-4'-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2,6-bis(6-methyl-2-pyridinyl)pyridine-4-carboxylate (CAS 372520-84-8) is a chemical compound with the molecular formula C20H19N3O2 and a molecular weight of 333.4 g/mol. IUPAC name: ethyl 2,6-bis(6-methyl-2-pyridinyl)pyridine-4-carboxylate. InChIKey: DNGNIRYAQCEXKI-UHFFFAOYSA-N.
| Molecular formula | C20H19N3O2 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | ethyl 2,6-bis(6-methyl-2-pyridinyl)pyridine-4-carboxylate |
| InChIKey | DNGNIRYAQCEXKI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NC(=C1)C2=CC=CC(=N2)C)C3=CC=CC(=N3)C |
Computed by PubChem (NCBI)