CAS 82597-82-8 is the registry number for Cyclo(-phe-trp), 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
3-benzyl-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione (CAS 82597-82-8) is a chemical compound with the molecular formula C20H19N3O2 and a molecular weight of 333.4 g/mol. IUPAC name: 3-benzyl-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione. InChIKey: CUVKAUWOMPJEMI-UHFFFAOYSA-N.
| Molecular formula | C20H19N3O2 |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 3-benzyl-6-(1H-indol-3-ylmethyl)piperazine-2,5-dione |
| InChIKey | CUVKAUWOMPJEMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2C(=O)NC(C(=O)N2)CC3=CNC4=CC=CC=C43 |
Computed by PubChem (NCBI)