Products 374635-48-0
CAS 374635-48-0 is the registry number for ALDH3A1-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(diethylamino)-3-nitrobenzaldehyde (CAS 374635-48-0) is a chemical compound with the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. IUPAC name: 4-(diethylamino)-3-nitrobenzaldehyde. InChIKey: GAIBXTKNUDDQMR-UHFFFAOYSA-N.
| Molecular formula | C11H14N2O3 |
|---|---|
| Molecular weight | 222.24 g/mol |
| IUPAC name | 4-(diethylamino)-3-nitrobenzaldehyde |
| InChIKey | GAIBXTKNUDDQMR-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=C(C=C(C=C1)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
4-(diethylamino)-3-nitrobenzaldehyde, orb1689738