Products 374679-27-3
CAS 374679-27-3 is the registry number for Vif-ElonginC interaction inhibitor 1. Offered by: MedChemExpress. Available pack sizes: Get quote.
Ethyl 7-benzoyl-3-(naphthalene-2-carbonyl)indolizine-1-carboxylate (CAS 374679-27-3) is a chemical compound with the molecular formula C29H21NO4 and a molecular weight of 447.5 g/mol. IUPAC name: ethyl 7-benzoyl-3-(naphthalene-2-carbonyl)indolizine-1-carboxylate. InChIKey: OMNFLCJXENKOCL-UHFFFAOYSA-N.
| Molecular formula | C29H21NO4 |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | ethyl 7-benzoyl-3-(naphthalene-2-carbonyl)indolizine-1-carboxylate |
| InChIKey | OMNFLCJXENKOCL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C2C=C(C=CN2C(=C1)C(=O)C3=CC4=CC=CC=C4C=C3)C(=O)C5=CC=CC=C5 |
Computed by PubChem (NCBI)