CAS 420106-23-6 is the registry number for ATXN1-MED15 PPI-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[2-[[4-(3-oxo-3-phenylprop-1-enyl)phenyl]carbamoyl]phenyl]benzoic acid (CAS 420106-23-6) is a chemical compound with the molecular formula C29H21NO4 and a molecular weight of 447.5 g/mol. IUPAC name: 2-[2-[[4-(3-oxo-3-phenylprop-1-enyl)phenyl]carbamoyl]phenyl]benzoic acid. InChIKey: XNYMPHBZSUCWTP-UHFFFAOYSA-N.
| Molecular formula | C29H21NO4 |
|---|---|
| Molecular weight | 447.5 g/mol |
| IUPAC name | 2-[2-[[4-(3-oxo-3-phenylprop-1-enyl)phenyl]carbamoyl]phenyl]benzoic acid |
| InChIKey | XNYMPHBZSUCWTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C=CC2=CC=C(C=C2)NC(=O)C3=CC=CC=C3C4=CC=CC=C4C(=O)O |
Computed by PubChem (NCBI)