Products 420106-23-6

CAS 420106-23-6 is the registry number for ATXN1-MED15 PPI-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

2-[2-[[4-(3-oxo-3-phenylprop-1-enyl)phenyl]carbamoyl]phenyl]benzoic acid (CAS 420106-23-6) is a chemical compound with the molecular formula C29H21NO4 and a molecular weight of 447.5 g/mol. IUPAC name: 2-[2-[[4-(3-oxo-3-phenylprop-1-enyl)phenyl]carbamoyl]phenyl]benzoic acid. InChIKey: XNYMPHBZSUCWTP-UHFFFAOYSA-N.

Identity
Molecular formulaC29H21NO4
Molecular weight447.5 g/mol
IUPAC name2-[2-[[4-(3-oxo-3-phenylprop-1-enyl)phenyl]carbamoyl]phenyl]benzoic acid
InChIKeyXNYMPHBZSUCWTP-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)C=CC2=CC=C(C=C2)NC(=O)C3=CC=CC=C3C4=CC=CC=C4C(=O)O

Computed by PubChem (NCBI)

Synonyms: orb3028470