CAS 374795-89-8 appears in our catalog under these names: 1-(3-Fluorophenyl)-4-oxocyclohexanecarboxylic acid, 95%, 1-(3-Fluorophenyl)-4-oxocyclohexanecarboxylic acid, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g, 25g.
1-(3-fluorophenyl)-4-oxocyclohexane-1-carboxylic acid (CAS 374795-89-8) is a chemical compound with the molecular formula C13H13FO3 and a molecular weight of 236.24 g/mol. IUPAC name: 1-(3-fluorophenyl)-4-oxocyclohexane-1-carboxylic acid. InChIKey: WJOVDFRUNBGQSX-UHFFFAOYSA-N.
| Molecular formula | C13H13FO3 |
|---|---|
| Molecular weight | 236.24 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-4-oxocyclohexane-1-carboxylic acid |
| InChIKey | WJOVDFRUNBGQSX-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1=O)(C2=CC(=CC=C2)F)C(=O)O |
Computed by PubChem (NCBI)