CAS 80912-58-9 is the registry number for 1-(4-Fluorophenyl)-4-oxocyclohexanecarboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
1-(4-fluorophenyl)-4-oxocyclohexane-1-carboxylic acid (CAS 80912-58-9) is a chemical compound with the molecular formula C13H13FO3 and a molecular weight of 236.24 g/mol. IUPAC name: 1-(4-fluorophenyl)-4-oxocyclohexane-1-carboxylic acid. InChIKey: LTNKWPQQEPDIFC-UHFFFAOYSA-N.
| Molecular formula | C13H13FO3 |
|---|---|
| Molecular weight | 236.24 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-4-oxocyclohexane-1-carboxylic acid |
| InChIKey | LTNKWPQQEPDIFC-UHFFFAOYSA-N |
| SMILES | C1CC(CCC1=O)(C2=CC=C(C=C2)F)C(=O)O |
Computed by PubChem (NCBI)