CAS 374898-00-7 appears in our catalog under these names: 1-Methyl-4-(phenylmethyl)piperazine Hydrochloride, >95% (HPLC), 1-Methyl-4-(phenylmethyl)piperazine Hydrochloride, 1-Methyl-4-(phenylmethyl)piperazine Hydrochloride 1.0 mg/ml in Methanol (as free base), MBZP (hydrochloride), 1-Benzyl-4-methylpiperazine hydrochloride. Offered by: TRC, LoGiCal, GLPBio, Biosynth. Available pack sizes: 100mg, 10mg, 1ml, 50mg, 2g, 5g, 10g, 25g.
1-benzyl-4-methylpiperazine;hydrochloride (CAS 374898-00-7) is a chemical compound with the molecular formula C12H19ClN2 and a molecular weight of 226.74 g/mol. IUPAC name: 1-benzyl-4-methylpiperazine;hydrochloride. InChIKey: NSKWYRZISOURNW-UHFFFAOYSA-N.
| Molecular formula | C12H19ClN2 |
|---|---|
| Molecular weight | 226.74 g/mol |
| IUPAC name | 1-benzyl-4-methylpiperazine;hydrochloride |
| InChIKey | NSKWYRZISOURNW-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)CC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)