Products 374918-94-2
CAS 374918-94-2 appears in our catalog under these names: 4-Methyl-7-phenoxy-1H,2H,3H,4H,9H-cyclopenta(b)quinolin-9-one, 95%, 4-Methyl-7-phenoxy-1H,2H,3H,4H,9H-cyclopenta(b)quinolin-9-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-methyl-7-phenoxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-one (CAS 374918-94-2) is a chemical compound with the molecular formula C19H17NO2 and a molecular weight of 291.3 g/mol. IUPAC name: 4-methyl-7-phenoxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-one. InChIKey: IEPAVMQFOSNIHD-UHFFFAOYSA-N.
| Molecular formula | C19H17NO2 |
|---|---|
| Molecular weight | 291.3 g/mol |
| IUPAC name | 4-methyl-7-phenoxy-2,3-dihydro-1H-cyclopenta[b]quinolin-9-one |
| InChIKey | IEPAVMQFOSNIHD-UHFFFAOYSA-N |
| SMILES | CN1C2=C(CCC2)C(=O)C3=C1C=CC(=C3)OC4=CC=CC=C4 |
Computed by PubChem (NCBI)