CAS 375-13-3 is the registry number for Heptafluorobutanoyl bromide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2,2,3,3,4,4,4-heptafluorobutanoyl bromide (CAS 375-13-3) is a chemical compound with the molecular formula C4BrF7O and a molecular weight of 276.93 g/mol. IUPAC name: 2,2,3,3,4,4,4-heptafluorobutanoyl bromide. InChIKey: PJYLUIOQPJDGIG-UHFFFAOYSA-N.
| Molecular formula | C4BrF7O |
|---|---|
| Molecular weight | 276.93 g/mol |
| IUPAC name | 2,2,3,3,4,4,4-heptafluorobutanoyl bromide |
| InChIKey | PJYLUIOQPJDGIG-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(F)(F)F)(F)F)(F)F)Br |
Computed by PubChem (NCBI)