Products 375-62-2

CAS 375-62-2 is the registry number for 2,2,3,3,4,4,5,5,5-Nonafluoropentanoyl fluoride. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.

Structural formula: {0} (CAS {1})

2,2,3,3,4,4,5,5,5-nonafluoropentanoyl fluoride (CAS 375-62-2) is a chemical compound with the molecular formula C5F10O and a molecular weight of 266.04 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,5-nonafluoropentanoyl fluoride. InChIKey: RUFSXELMOQBMOF-UHFFFAOYSA-N.

Identity
Molecular formulaC5F10O
Molecular weight266.04 g/mol
IUPAC name2,2,3,3,4,4,5,5,5-nonafluoropentanoyl fluoride
InChIKeyRUFSXELMOQBMOF-UHFFFAOYSA-N
SMILESC(=O)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)F

Computed by PubChem (NCBI)