CAS 375-62-2 is the registry number for 2,2,3,3,4,4,5,5,5-Nonafluoropentanoyl fluoride. Offered by: Chemat. Available pack sizes: 1g, 5g, 25g.
2,2,3,3,4,4,5,5,5-nonafluoropentanoyl fluoride (CAS 375-62-2) is a chemical compound with the molecular formula C5F10O and a molecular weight of 266.04 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,5-nonafluoropentanoyl fluoride. InChIKey: RUFSXELMOQBMOF-UHFFFAOYSA-N.
| Molecular formula | C5F10O |
|---|---|
| Molecular weight | 266.04 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,5-nonafluoropentanoyl fluoride |
| InChIKey | RUFSXELMOQBMOF-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)F |
Computed by PubChem (NCBI)