CAS 756-12-7 appears in our catalog under these names: Heptafluoroisopropyl trifluoromethyl ketone, 95%, Heptafluoroisopropyl trifluoromethyl ketone, 95%, 95%, 1,1,1,3,4,4,4-Heptafluoro-3-(trifluoromethyl)butan-2-one, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 1g, 250mg, 100g.
1,1,1,3,4,4,4-heptafluoro-3-(trifluoromethyl)butan-2-one (CAS 756-12-7) is a chemical compound with the molecular formula C5F10O and a molecular weight of 266.04 g/mol. IUPAC name: 1,1,1,3,4,4,4-heptafluoro-3-(trifluoromethyl)butan-2-one. InChIKey: ABQIAHFCJGVSDJ-UHFFFAOYSA-N.
| Molecular formula | C5F10O |
|---|---|
| Molecular weight | 266.04 g/mol |
| IUPAC name | 1,1,1,3,4,4,4-heptafluoro-3-(trifluoromethyl)butan-2-one |
| InChIKey | ABQIAHFCJGVSDJ-UHFFFAOYSA-N |
| SMILES | C(=O)(C(C(F)(F)F)(C(F)(F)F)F)C(F)(F)F |
Computed by PubChem (NCBI)