Products 37520-24-4

CAS 37520-24-4 appears in our catalog under these names: 3,3-Dicyclopropylprop-2-enoic acid, 95%, 3,3-Dicyclopropylprop-2-enoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.

3,3-dicyclopropylprop-2-enoic acid (CAS 37520-24-4) is a chemical compound with the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. IUPAC name: 3,3-dicyclopropylprop-2-enoic acid. InChIKey: QVWBGJABCTUBOO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H12O2
Molecular weight152.19 g/mol
IUPAC name3,3-dicyclopropylprop-2-enoic acid
InChIKeyQVWBGJABCTUBOO-UHFFFAOYSA-N
SMILESC1CC1C(=CC(=O)O)C2CC2

Computed by PubChem (NCBI)